5-[(4-chlorophenyl)diazenyl]pyrimidine-2,4,6-triamine structure
|
Common Name | 5-[(4-chlorophenyl)diazenyl]pyrimidine-2,4,6-triamine | ||
|---|---|---|---|---|
| CAS Number | 2878-02-6 | Molecular Weight | 263.68600 | |
| Density | 1.69g/cm3 | Boiling Point | 621.9ºC at 760 mmHg | |
| Molecular Formula | C10H10ClN7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.9ºC | |
| Name | 5-[(4-chlorophenyl)diazenyl]pyrimidine-2,4,6-triamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 621.9ºC at 760 mmHg |
| Molecular Formula | C10H10ClN7 |
| Molecular Weight | 263.68600 |
| Flash Point | 329.9ºC |
| Exact Mass | 263.06900 |
| PSA | 130.02000 |
| LogP | 2.73340 |
| Vapour Pressure | 2.17E-15mmHg at 25°C |
| Index of Refraction | 1.796 |
| InChIKey | XUQMIWAPQCNILJ-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c(N=Nc2ccc(Cl)cc2)c(N)n1 |
|
~%
5-[(4-chlorophe... CAS#:2878-02-6 |
| Literature: Belodedova, Zh. V.; Smorygo, N. A.; Mirzoyan, V. S.; Melik-Orandzhanyan, R. G.; Studentsov, E. P.; Ivin, B. A. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1988 , p. 538 - 545 Khimiya Geterotsiklicheskikh Soedinenii, 1988 , vol. 24, # 5 p. 659 - 667 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,6-Triamino-5-<4-chlor-phenylazo>-pyrimidin |
| 2,4,6-Triamino-5-p-chlorphenylazo-pyrimidin |
| PY-61 |