6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one
Modify Date: 2026-09-28 16:57:47
![6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one Structure](https://www.chemsrc.com/extcaspic/244/2878503-29-6.png)
6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one structure
|
Common Name | 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one | ||
|---|---|---|---|---|
| CAS Number | 2878503-29-6 | Molecular Weight | 211.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10ClN3O |
|---|---|
| Molecular Weight | 211.65 |
| InChIKey | HDXDUKUGXOTWRS-UHFFFAOYSA-N |
| SMILES | CC(C)n1[nH]c(=O)c2ccc(Cl)nc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2878503-29-6? |
| A: Chinese name of 2878503-29-6 is 2878503-29-6. |
| Q: What is the molecular weight of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one? |
| A: Molecular weight of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one is 211.65. |
| Q: What is the English name of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one? |
| A: The English name of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one is 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one. |
| Q: What is the InChIKey of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one? |
| A: InChIKey of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one is HDXDUKUGXOTWRS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one? |
| A: Molecular formula of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one is C9H10ClN3O. |
| Q: What is the SMILES notation of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one? |
| A: SMILES notation of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one is CC(C)n1[nH]c(=O)c2ccc(Cl)nc21. |
| Q: What is the CAS number of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one? |
| A: CAS number of 6-chloro-1-isopropyl-2H-pyrazolo[3,4-b]pyridin-3-one is 2878503-29-6. |