(4aα,8aα)-Decalin-4a,8a-diol
(4aα,8aα)-Decalin-4a,8a-diol structure
|
Common Name | (4aα,8aα)-Decalin-4a,8a-diol | ||
|---|---|---|---|---|
| CAS Number | 28795-95-1 | Molecular Weight | 162.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | cis-1,6-dihydroxybicyclo[4.4.0]decane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10O2 |
|---|---|
| Molecular Weight | 162.18 |
| Exact Mass | 162.068079557 |
| PSA | 40.46000 |
| LogP | 1.59660 |
| InChIKey | DWXYQVLQVYPALI-UHFFFAOYSA-N |
| SMILES | C1=CC2(C=CC=CC2(C=C1)O)O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| cis-decalin-9,10-diol |
| cis-4a,8a-decalindiol |
| cis-9,10-decalinediol |
| CIS-9 10-DECALINDIOL |
| cis-9,10-dihydroxydecalin |
| cis-9,10-Decalindiol |
| cis-9,10-dihydroxydecaline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: InChIKey of cis-1,6-dihydroxybicyclo[4.4.0]decane is DWXYQVLQVYPALI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: Molecular formula of cis-1,6-dihydroxybicyclo[4.4.0]decane is C10H10O2. |
| Q: What is the Chinese name of 28795-95-1? |
| A: Chinese name of 28795-95-1 is 28795-95-1. |
| Q: What is the CAS number of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: CAS number of cis-1,6-dihydroxybicyclo[4.4.0]decane is 28795-95-1. |
| Q: What English synonyms does cis-1,6-dihydroxybicyclo[4.4.0]decane have? |
| A: English synonyms of cis-1,6-dihydroxybicyclo[4.4.0]decane: cis-decalin-9,10-diol, cis-4a,8a-decalindiol, cis-9,10-decalinediol, CIS-9 10-DECALINDIOL, cis-9,10-dihydroxydecalin, cis-9,10-Decalindiol, cis-9,10-dihydroxydecaline. |
| Q: What is the English name of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: The English name of cis-1,6-dihydroxybicyclo[4.4.0]decane is cis-1,6-dihydroxybicyclo[4.4.0]decane. |
| Q: What is the molecular weight of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: Molecular weight of cis-1,6-dihydroxybicyclo[4.4.0]decane is 162.18. |
| Q: What is the LogP of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: LogP of cis-1,6-dihydroxybicyclo[4.4.0]decane is 1.59660. |
| Q: What is the SMILES notation of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: SMILES notation of cis-1,6-dihydroxybicyclo[4.4.0]decane is C1=CC2(C=CC=CC2(C=C1)O)O. |
| Q: What is the polar surface area (PSA) of cis-1,6-dihydroxybicyclo[4.4.0]decane? |
| A: Polar surface area (PSA) of cis-1,6-dihydroxybicyclo[4.4.0]decane is 40.46000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |