9-Amino(9-deoxy)epi-quinidinetrihydrochloride
9-Amino(9-deoxy)epi-quinidinetrihydrochloride structure
|
Common Name | 9-Amino(9-deoxy)epi-quinidinetrihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 287979-82-2 | Molecular Weight | 323.43200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H25N3O |
|---|---|
| Molecular Weight | 323.43200 |
| Exact Mass | 323.20000 |
| PSA | 51.38000 |
| LogP | 3.77780 |
| InChIKey | RIEKOKLABHBCGI-AFHBHXEDSA-N |
| SMILES | C=CC1CN2CCC1CC2C(N)c1ccnc2ccc(OC)cc12 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9-amino(9-deoxy)epiquinidine |
| 9-amino-9-(deoxy)epiquinidinine |
| 9-amino-9-deoxi-epiquinidine |
| 9-amino-9-deoxy-epi-quinidine |
| 9-amino-(9-deoxy)epiquinidine |
| 9-amino(9-deoxy)epi-quinidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: InChIKey of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is RIEKOKLABHBCGI-AFHBHXEDSA-N. |
| Q: What is the CAS number of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: CAS number of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is 287979-82-2. |
| Q: What is the polar surface area (PSA) of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: Polar surface area (PSA) of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is 51.38000. |
| Q: What is the English name of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: The English name of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline. |
| Q: What is the molecular formula of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: Molecular formula of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is C20H25N3O. |
| Q: What English synonyms does 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline have? |
| A: English synonyms of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline: 9-amino(9-deoxy)epiquinidine, 9-amino-9-(deoxy)epiquinidinine, 9-amino-9-deoxi-epiquinidine, 9-amino-9-deoxy-epi-quinidine, 9-amino-(9-deoxy)epiquinidine, 9-amino(9-deoxy)epi-quinidine. |
| Q: What is the SMILES notation of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: SMILES notation of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is C=CC1CN2CCC1CC2C(N)c1ccnc2ccc(OC)cc12. |
| Q: What is the LogP of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: LogP of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is 3.77780. |
| Q: What is the molecular weight of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline? |
| A: Molecular weight of 4-[(R)-amino[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline is 323.43200. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |