Hydroxycitric acid lactone
Modify Date: 2026-04-14 18:20:33
Hydroxycitric acid lactone structure
|
Common Name | Hydroxycitric acid lactone | ||
|---|---|---|---|---|
| CAS Number | 28809-16-7 | Molecular Weight | 190.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Hydroxycitric acid lactone |
|---|
| Molecular Formula | C6H6O7 |
|---|---|
| Molecular Weight | 190.11 |
| InChIKey | PFHZIWAVXDSFTB-CVYQJGLWSA-N |
| SMILES | C1C(=O)O[C@@H]([C@@]1(C(=O)O)O)C(=O)O |
|
Name: Inhibition of rat liver ACLY
Source: ChEMBL
Target: ATP-citrate synthase
External Id: CHEMBL4275768
|
Total 1, Current Page 1 of 1
1