5,8-DIFLUORO-2-METHYL-QUINOLIN-4-OL structure
|
Common Name | 5,8-DIFLUORO-2-METHYL-QUINOLIN-4-OL | ||
|---|---|---|---|---|
| CAS Number | 288151-26-8 | Molecular Weight | 195.16500 | |
| Density | 1.314g/cm3 | Boiling Point | 267.6ºC at 760 mmHg | |
| Molecular Formula | C10H7F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.6ºC | |
| Name | 5,8-difluoro-2-methyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 267.6ºC at 760 mmHg |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.16500 |
| Flash Point | 115.6ºC |
| Exact Mass | 195.05000 |
| PSA | 33.12000 |
| LogP | 2.52700 |
| Vapour Pressure | 0.00809mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | SEORIAWRWRGAAN-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(F)ccc(F)c2[nH]1 |
| HS Code | 2933499090 |
|---|
|
~%
5,8-DIFLUORO-2-... CAS#:288151-26-8 |
| Literature: SmithKline Beecham p.l.c. Patent: US6699879 B1, 2004 ; Location in patent: Page/Page column 14 ; |
|
~%
5,8-DIFLUORO-2-... CAS#:288151-26-8 |
| Literature: SmithKline Beecham p.l.c. Patent: US6699879 B1, 2004 ; Location in patent: Page/Page column 14 ; |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,8-Difluoro-4-hydroxy-2-methyl-quinoline |
| 5,8-difluoro-2-methylquinolin-4-ol |
| 4-hydroxy-5,8-difluoro-2-methylquinoline |