s-n-(-)-p-tolylsulfinyltryptamine 97 structure
|
Common Name | s-n-(-)-p-tolylsulfinyltryptamine 97 | ||
|---|---|---|---|---|
| CAS Number | 288159-11-5 | Molecular Weight | 298.40300 | |
| Density | 1.295g/cm3 | Boiling Point | 540.087ºC at 760 mmHg | |
| Molecular Formula | C17H18N2OS | Melting Point | 110-114ºC(lit.) | |
| MSDS | USA | Flash Point | 280.435ºC | |
| Name | N-[2-(1H-Indol-3-yl)ethyl]-4-methylbenzenesulfinamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 540.087ºC at 760 mmHg |
| Melting Point | 110-114ºC(lit.) |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.40300 |
| Flash Point | 280.435ºC |
| Exact Mass | 298.11400 |
| PSA | 64.10000 |
| LogP | 4.58780 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.703 |
| InChIKey | GDHYCLNHSKWYMD-OAQYLSRUSA-N |
| SMILES | Cc1ccc(S(=O)NCCc2c[nH]c3ccccc23)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| MFCD04122692 |
| (S)-N-(-)-p-Tolylsulfinyltryptamine |