Ethanone,1-(4-methyl-2-phenyl-1H-imidazol-5-yl)- structure
|
Common Name | Ethanone,1-(4-methyl-2-phenyl-1H-imidazol-5-yl)- | ||
|---|---|---|---|---|
| CAS Number | 28824-91-1 | Molecular Weight | 200.23600 | |
| Density | 1.15g/cm3 | Boiling Point | 418.3ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | 1-(5-methyl-2-phenyl-1H-imidazol-4-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 418.3ºC at 760 mmHg |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.23600 |
| Flash Point | 208.4ºC |
| Exact Mass | 200.09500 |
| PSA | 45.75000 |
| LogP | 2.58770 |
| Vapour Pressure | 3.32E-07mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | RAFHDKLDMHYNOT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1nc(-c2ccccc2)[nH]c1C |
| Storage condition | 2-8°C |
|
~72%
Ethanone,1-(4-m... CAS#:28824-91-1 |
| Literature: Veronese, A.C.; Cavicchioni, G.; Servadio, G.; Vecchiati, G. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1723 - 1725 |
|
~%
Ethanone,1-(4-m... CAS#:28824-91-1 |
| Literature: Veronese, A.C.; Cavicchioni, G.; Servadio, G.; Vecchiati, G. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1723 - 1725 |
|
~%
Ethanone,1-(4-m... CAS#:28824-91-1 |
| Literature: Veronese, A.C.; Cavicchioni, G.; Servadio, G.; Vecchiati, G. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1723 - 1725 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| methyl 5-methyl-2-phenyl-4-imidazolyl ketone |
| 4-Acetyl-5-methyl-2-phenylimidazole |
| 1-(5-methyl-2-phenyl-1(3)H-imidazol-4-yl)-ethanone |
| 4-Acetyl-5-methyl-2-phenyl-imidazol |
| 4(5)-Methyl-2-phenyl-5(4)-acetyl-imidazol |
| 2-phenyl-4-acetyl-5-methylimidazole |
| 4-acetyl-5-methyl-2-phenylimdazole |