tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate
Modify Date: 2026-07-03 18:44:14
tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate structure
|
Common Name | tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate | ||
|---|---|---|---|---|
| CAS Number | 2882952-89-6 | Molecular Weight | 319.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26BNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H26BNO4 |
|---|---|
| Molecular Weight | 319.2 |
| InChIKey | HAQDGRLUMZICQR-UHFFFAOYSA-N |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)c(C(=O)OC(C)(C)C)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate? |
| A: SMILES notation of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate is Cc1cc(B2OC(C)(C)C(C)(C)O2)c(C(=O)OC(C)(C)C)cn1. |
| Q: What is the molecular formula of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate? |
| A: Molecular formula of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate is C17H26BNO4. |
| Q: What is the InChIKey of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate? |
| A: InChIKey of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate is HAQDGRLUMZICQR-UHFFFAOYSA-N. |
| Q: What is the CAS number of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate? |
| A: CAS number of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate is 2882952-89-6. |
| Q: What is the English name of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate? |
| A: The English name of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate is tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate. |
| Q: What is the molecular weight of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate? |
| A: Molecular weight of tert-Butyl 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate is 319.2. |
| Q: What is the Chinese name of 2882952-89-6? |
| A: Chinese name of 2882952-89-6 is 2882952-89-6. |