dl-leu-dl-leu
dl-leu-dl-leu structure
|
Common Name | dl-leu-dl-leu | ||
|---|---|---|---|---|
| CAS Number | 2883-36-5 | Molecular Weight | 244.33100 | |
| Density | 1.051g/cm3 | Boiling Point | 432.7ºC at 760mmHg | |
| Molecular Formula | C12H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.5ºC | |
Summary: dl-leu-dl-leu, Chinese name: dl-亮-亮, CAS number: 2883-36-5, molecular formula: C12H24N2O3, molecular weight: 244.33100. The density is 1.051g/cm3 and the boiling point is 432.7ºC. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dl-leu-dl-leu |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 432.7ºC at 760mmHg |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33100 |
| Flash Point | 215.5ºC |
| Exact Mass | 244.17900 |
| PSA | 92.42000 |
| LogP | 2.06650 |
| Vapour Pressure | 1.07E-08mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | LCPYQJIKPJDLLB-UHFFFAOYSA-N |
| SMILES | CC(C)CC(N)C(=O)NC(CC(C)C)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| WGK Germany | 3 |
|---|---|
| HS Code | 2924199090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
dl-leu-dl-leu CAS#:2883-36-5 |
| Literature: Fischer,E. Chemische Berichte, 1904 , vol. 37, p. 2490 |
|
~%
dl-leu-dl-leu CAS#:2883-36-5 |
| Literature: Fischer,E. Chemische Berichte, 1904 , vol. 37, p. 2490 |
|
~%
dl-leu-dl-leu CAS#:2883-36-5 |
| Literature: Fischer,E. Chemische Berichte, 1904 , vol. 37, p. 2490 |
|
~%
dl-leu-dl-leu CAS#:2883-36-5 |
| Literature: Fischer,E. Chemische Berichte, 1906 , vol. 39, p. 2916 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
CAS#:3303-31-9
CAS#:17665-02-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| DL-Leucin-DL-leucin |
| leucovorin calcium |
| Leucylleucin |
| 5-formyl-5,6,7,8-tetrahydropteroyl-L-glutamic acid calcium salt |
| Folinic acid calcium salt |
| FOLINIC ACID CALCIUM CELL CULTURE TESTED |
| N-Leucyl-alanin |
| Leucovorin calcium pentahydrate |
| N-leucyl-leucine |
| Folaren |
| H-Leu-Ala-OH |
| leucylleucine |
| Foliben |
| Folidan |
| DL-Leucyl-DL-alanine |
| N-Leucyl-leucin |
| leucylalanine |
| N-leucyl-alanine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of dl-leu-dl-leu? |
| A: InChIKey of dl-leu-dl-leu is LCPYQJIKPJDLLB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of dl-leu-dl-leu? |
| A: SMILES notation of dl-leu-dl-leu is CC(C)CC(N)C(=O)NC(CC(C)C)C(=O)O. |
| Q: What is the molecular weight of dl-leu-dl-leu? |
| A: Molecular weight of dl-leu-dl-leu is 244.33100. |
| Q: What are the upstream materials of dl-leu-dl-leu? |
| A: Related upstream materials(CAS) of dl-leu-dl-leu: 328-39-2;28659-88-3;61-90-5. |
| Q: What is the English name of dl-leu-dl-leu? |
| A: The English name of dl-leu-dl-leu is dl-leu-dl-leu. |
| Q: What is the polar surface area (PSA) of dl-leu-dl-leu? |
| A: Polar surface area (PSA) of dl-leu-dl-leu is 92.42000. |
| Q: What English synonyms does dl-leu-dl-leu have? |
| A: English synonyms of dl-leu-dl-leu: DL-Leucin-DL-leucin, leucovorin calcium, Leucylleucin, 5-formyl-5,6,7,8-tetrahydropteroyl-L-glutamic acid calcium salt, Folinic acid calcium salt, FOLINIC ACID CALCIUM CELL CULTURE TESTED, N-Leucyl-alanin, Leucovorin calcium pentahydrate, N-leucyl-leucine, Folaren, H-Leu-Ala-OH, leucylleucine, Foliben, Folidan, DL-Leucyl-DL-alanine, N-Leucyl-leucin, leucylalanine, N-leucyl-alanine. |
| Q: What is the LogP of dl-leu-dl-leu? |
| A: LogP of dl-leu-dl-leu is 2.06650. |
| Q: What is the molecular formula of dl-leu-dl-leu? |
| A: Molecular formula of dl-leu-dl-leu is C12H24N2O3. |
| Q: What is the boiling point of dl-leu-dl-leu? |
| A: Boiling point of dl-leu-dl-leu is 432.7ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |