4-(chloromethyl)-2-methylquinoline structure
|
Common Name | 4-(chloromethyl)-2-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 288399-19-9 | Molecular Weight | 191.65700 | |
| Density | 1.192g/cm3 | Boiling Point | 316.779ºC at 760 mmHg | |
| Molecular Formula | C11H10ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.734ºC | |
| Name | 4-(chloromethyl)-2-methylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 316.779ºC at 760 mmHg |
| Molecular Formula | C11H10ClN |
| Molecular Weight | 191.65700 |
| Flash Point | 174.734ºC |
| Exact Mass | 191.05000 |
| PSA | 12.89000 |
| LogP | 3.28200 |
| Vapour Pressure | 0.001mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | GRCWGPJQMVGBNY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1)CCl |
| HS Code | 2933499090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloromethyl-2-methylquinoline |
| 2-methyl-4-chloromethylquinoline |