2-(2-methoxyphenoxy)-1-[4-[2-(2-methoxyphenoxy)acetyl]piperazin-1-yl]ethanone structure
|
Common Name | 2-(2-methoxyphenoxy)-1-[4-[2-(2-methoxyphenoxy)acetyl]piperazin-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 2884-28-8 | Molecular Weight | 414.45200 | |
| Density | 1.233g/cm3 | Boiling Point | 629.1ºC at 760mmHg | |
| Molecular Formula | C22H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.3ºC | |
| Name | 2-(2-methoxyphenoxy)-1-[4-[2-(2-methoxyphenoxy)acetyl]piperazin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 629.1ºC at 760mmHg |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.45200 |
| Flash Point | 334.3ºC |
| Exact Mass | 414.17900 |
| PSA | 77.54000 |
| LogP | 1.70820 |
| Vapour Pressure | 9.71E-16mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | AGTJUFFDJQCSAP-UHFFFAOYSA-N |
| SMILES | COc1ccccc1OCC(=O)N1CCN(C(=O)COc2ccccc2OC)CC1 |
|
~58%
2-(2-methoxyphe... CAS#:2884-28-8 |
| Literature: Chauhan, Jaya; Chauhan, J. S.; Gupta, P. P.; Srimal, R. C. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 2 p. 305 - 307 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| f1443-1402 |
| ap 11 |