CID 11772568
Modify Date: 2025-09-13 07:30:18
CID 11772568 structure
|
Common Name | CID 11772568 | ||
|---|---|---|---|---|
| CAS Number | 288401-45-6 | Molecular Weight | 352.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H36O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 11772568 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H36O |
|---|---|
| Molecular Weight | 352.6 |
| InChIKey | XINZQXGRBFSLOC-XIQMRYHBSA-N |
| SMILES | CC(C)=C=C(C)CCC(C=CC1(COCc2ccccc2)CC1)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of CID 11772568? |
| A: SMILES notation of CID 11772568 is CC(C)=C=C(C)CCC(C=CC1(COCc2ccccc2)CC1)C(C)C. |
| Q: What is the Chinese name of 288401-45-6? |
| A: Chinese name of 288401-45-6 is 288401-45-6. |
| Q: What is the English name of CID 11772568? |
| A: The English name of CID 11772568 is CID 11772568. |
| Q: What is the InChIKey of CID 11772568? |
| A: InChIKey of CID 11772568 is XINZQXGRBFSLOC-XIQMRYHBSA-N. |
| Q: What is the molecular weight of CID 11772568? |
| A: Molecular weight of CID 11772568 is 352.6. |
| Q: What is the CAS number of CID 11772568? |
| A: CAS number of CID 11772568 is 288401-45-6. |
| Q: What is the molecular formula of CID 11772568? |
| A: Molecular formula of CID 11772568 is C25H36O. |