Fmoc-(S)-2-(4-pentenyl)Ala-OH structure
|
Common Name | Fmoc-(S)-2-(4-pentenyl)Ala-OH | ||
|---|---|---|---|---|
| CAS Number | 288617-73-2 | Molecular Weight | 379.449 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 591.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C23H25NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 311.7±28.7 °C | |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 591.7±45.0 °C at 760 mmHg |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.449 |
| Flash Point | 311.7±28.7 °C |
| Exact Mass | 379.178345 |
| PSA | 75.63000 |
| LogP | 5.65 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | MRJFPZWLOJOINV-QHCPKHFHSA-N |
| SMILES | C=CCCCC(C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Storage condition | ?20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L B656 HHJ H1OVMX1&VQ4U1 |
| Fmoc-(S)-2-(4-pentenyl)Ala-OH |
| (S)-N-Fmoc-α-(4-pentenyl)alanine |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-2-methyl-6-heptenoic acid |
| (S)-2-{[(9H-Fluoren-9-yl)methoxy]carbonylamino}-2-methylhept-6-enoic acid |
| 6-Heptenoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, (2S)- |
| N-Fmoc-α-(4-Pentenyl)-L-alanine |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-2-methylhept-6-enoic acid |