ethyl 3-phenyl-4H-1,4-benzothiazine-2-carboxylate structure
|
Common Name | ethyl 3-phenyl-4H-1,4-benzothiazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 28863-86-7 | Molecular Weight | 297.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-phenyl-4H-1,4-benzothiazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO2S |
|---|---|
| Molecular Weight | 297.37200 |
| Exact Mass | 297.08200 |
| PSA | 63.63000 |
| LogP | 4.27410 |
| InChIKey | LXJQLFLAKRJNEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(c2ccccc2)Nc2ccccc2S1 |
|
~%
ethyl 3-phenyl-... CAS#:28863-86-7 |
| Literature: Liso, Gaetano; Trapani, Giuseppe; Reho, Antonia; Latrofa, Andrea; Loiodice, Fulvio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 567 - 572 |
|
~85%
ethyl 3-phenyl-... CAS#:28863-86-7
Detail
|
| Literature: Liso, Gaetano; Trapani, Giuseppe; Reho, Antonia; Latrofa, Andrea; Loiodice, Fulvio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 567 - 572 |
|
~%
ethyl 3-phenyl-... CAS#:28863-86-7 |
| Literature: Sakoda, Vianne M.; Whittle, Robert R.; Olofson, R. A. Tetrahedron Letters, 1984 , vol. 25, # 25 p. 2635 - 2638 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-carbethoxy-3-phenyl-4H-<1,4>-benzothiazine |
| 4H-1,4-Benzothiazine-2-carboxylic acid,3-phenyl-,ethyl ester |
| 3-Phenyl-2-carbaethoxy-4H-1,4-benzothiazin |
| 2-ethoxycarbonyl-3-phenyl-4H-1,4-benzothiazine |