1-(2'-aminobenzoyl)-2-benzoylhydrazine structure
|
Common Name | 1-(2'-aminobenzoyl)-2-benzoylhydrazine | ||
|---|---|---|---|---|
| CAS Number | 28864-27-9 | Molecular Weight | 255.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2'-aminobenzoyl)-2-benzoylhydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13N3O2 |
|---|---|
| Molecular Weight | 255.27200 |
| Exact Mass | 255.10100 |
| PSA | 84.22000 |
| LogP | 2.70660 |
| InChIKey | PRFZPINUJVSKGJ-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)NNC(=O)c1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-N-benzoylanthranilohydrazide |
| 2-amino-benzoic acid N'-benzoyl-hydrazide |
| N-Benzoyl-N'-(2-amino-benzoyl)-hydrazin |
| Anthranilsaeure-benzoylhydrazid |
| N-anthraniloyl-N'-benzoyl-hydrazine |
| N-Anthraniloyl-N'-benzoyl-hydrazin |