DGKα-IN-8
Modify Date: 2024-04-07 16:50:54
DGKα-IN-8 structure
|
Common Name | DGKα-IN-8 | ||
|---|---|---|---|---|
| CAS Number | 2886717-70-8 | Molecular Weight | 473.88 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H19ClF3N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DGKα-IN-8DGKα-IN-8 (Example 51) is a DGKα inhibitor (IC50=22.491 nM; EC50=0.256 nM). DGKα-IN-8 can be used to study cancer, including solid tumors, and viral infections, such as HIV or hepatitis B virus infection[1]. |
| Name | DGKα-IN-8 |
|---|
| Description | DGKα-IN-8 (Example 51) is a DGKα inhibitor (IC50=22.491 nM; EC50=0.256 nM). DGKα-IN-8 can be used to study cancer, including solid tumors, and viral infections, such as HIV or hepatitis B virus infection[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 22.491 nM (DGKα)[1]. |
| References |
[1]. Julian A Codelli, et al. Diacylglyercol kinase modulating compounds. Patent WO2022271659A1. |
| Molecular Formula | C23H19ClF3N5O |
|---|---|
| Molecular Weight | 473.88 |
| InChIKey | AZQWRUDQALWXQL-UHFFFAOYSA-N |
| SMILES | Cn1nnc2nc(N(CC(F)F)c3cc(F)cc(C#CC(C)(C)O)c3)c3ccc(Cl)cc3c21 |