1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene structure
|
Common Name | 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene | ||
|---|---|---|---|---|
| CAS Number | 2889-58-9 | Molecular Weight | 201.26400 | |
| Density | 0.92g/cm3 | Boiling Point | 275.6ºC at 760mmHg | |
| Molecular Formula | C13H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 84ºC | |
Summary: 1-(2-Iso cyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene, CAS number 2889-58-9, molecular formula C13H15NO, molecular weight 201.26400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 275.6ºC at 760mmHg |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.26400 |
| Flash Point | 84ºC |
| Exact Mass | 201.11500 |
| PSA | 29.43000 |
| LogP | 3.29060 |
| Vapour Pressure | 0.00504mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | JRLLJITWABKEKE-UHFFFAOYSA-N |
| SMILES | C=C(C)c1ccc(C(C)(C)N=C=O)cc1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| RIDADR | UN 2206 |
|---|---|
| Packaging Group | II |
| Hazard Class | 6.1(a) |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(2-isocyanato... CAS#:2889-58-9 |
| Literature: Hoover,F.W.; Rothrock,H.S. Journal of Organic Chemistry, 1964 , vol. 29, p. 143 - 145 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: The English name of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene. |
| Q: What is the CAS number of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: CAS number of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is 2889-58-9. |
| Q: What is the polar surface area (PSA) of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: Polar surface area (PSA) of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is 29.43000. |
| Q: What is the molecular weight of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: Molecular weight of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is 201.26400. |
| Q: What is the SMILES notation of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: SMILES notation of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is C=C(C)c1ccc(C(C)(C)N=C=O)cc1. |
| Q: What is the molecular formula of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: Molecular formula of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is C13H15NO. |
| Q: What are the upstream materials of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: Related upstream materials(CAS) of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene: 75-13-8;1605-18-1. |
| Q: What is the LogP of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: LogP of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is 3.29060. |
| Q: What is the boiling point of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: Boiling point of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is 275.6ºC at 760mmHg. |
| Q: What is the InChIKey of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene? |
| A: InChIKey of 1-(2-isocyanatopropan-2-yl)-4-prop-1-en-2-ylbenzene is JRLLJITWABKEKE-UHFFFAOYSA-N. |