Oleocanthal structure
|
Common Name | Oleocanthal | ||
|---|---|---|---|---|
| CAS Number | 289030-99-5 | Molecular Weight | 304.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OleocanthalOleocanthal is a phenylethanoid, or a type of natural phenolic compound found in extra-virgin olive oil. Oleocanthal is a tyrosol ester and its chemical structure is related to oleuropein, also found in olive oil. |
| Name | oleocanthal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20O5 |
|---|---|
| Molecular Weight | 304.33800 |
| Exact Mass | 304.13100 |
| PSA | 80.67000 |
| LogP | 2.21840 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | VPOVFCBNUOUZGG-VAKDEWRISA-N |
| SMILES | CC=C(C=O)C(CC=O)CC(=O)OCCc1ccc(O)cc1 |
| Storage condition | -20°C |
| 2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate |
| UNII-AC7QO6038O |
| Deacetoxy ligstroside aglycon |
| 2-(4-Hydroxyphenyl)ethyl (3S,4E)-4-formyl-3-(2-oxoethyl)hex-4-enoate |
| (3S,4E)-4-Formyl-3-(2-oxoethyl)-4-hexenoic acid 2-(4-hydroxyphenyl)ethyl ester |