RAD16-I structure
|
Common Name | RAD16-I | ||
|---|---|---|---|---|
| CAS Number | 289042-25-7 | Molecular Weight | 1712.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C66H113N29O25 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RAD16-IRAD16-I, a soft nanofibrous self-assembling peptide, is a suitable microenvironment for human mesenchymal stem cells’ (hMSC) proliferation and differentiation into chondrocytes[1]. RAD16-I is a well-studied ionic complementary peptide was used as a model to check potential amyloid-like staining properties of SAPNFs[2]. |
| Name | RAD16-I |
|---|
| Description | RAD16-I, a soft nanofibrous self-assembling peptide, is a suitable microenvironment for human mesenchymal stem cells’ (hMSC) proliferation and differentiation into chondrocytes[1]. RAD16-I is a well-studied ionic complementary peptide was used as a model to check potential amyloid-like staining properties of SAPNFs[2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C66H113N29O25 |
|---|---|
| Molecular Weight | 1712.78 |
| InChIKey | MXRLSGRWOVUTRA-ILUXXBGNSA-N |
| SMILES | CC(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(C)C(N)=O |