rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate
Modify Date: 2025-08-21 19:13:52
rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate structure
|
Common Name | rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2892025-33-9 | Molecular Weight | 263.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO3 |
|---|---|
| Molecular Weight | 263.33 |
| InChIKey | IDKDYGOJMHLITM-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC1c1ccc(CO)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate? |
| A: InChIKey of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate is IDKDYGOJMHLITM-OLZOCXBDSA-N. |
| Q: What is the molecular formula of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate? |
| A: Molecular formula of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate is C15H21NO3. |
| Q: What is the English name of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate? |
| A: The English name of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate is rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate. |
| Q: What is the Chinese name of 2892025-33-9? |
| A: Chinese name of 2892025-33-9 is 2892025-33-9. |
| Q: What is the CAS number of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate? |
| A: CAS number of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate is 2892025-33-9. |
| Q: What is the molecular weight of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate? |
| A: Molecular weight of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate is 263.33. |
| Q: What is the SMILES notation of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate? |
| A: SMILES notation of rel-tert-Butyl ((1S,2R)-2-(4-(hydroxymethyl)phenyl)cyclopropyl)carbamate is CC(C)(C)OC(=O)NC1CC1c1ccc(CO)cc1. |