Thiourea,N-(2-methylpyridinio)-N'-phenyl-, inner salt structure
|
Common Name | Thiourea,N-(2-methylpyridinio)-N'-phenyl-, inner salt | ||
|---|---|---|---|---|
| CAS Number | 28937-20-4 | Molecular Weight | 243.32700 | |
| Density | 1.22g/cm3 | Boiling Point | 360ºC at 760mmHg | |
| Molecular Formula | C13H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | N-(2-methylpyridin-1-ium-1-yl)-N'-phenylcarbamimidothioate |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760mmHg |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.32700 |
| Flash Point | 171.5ºC |
| Exact Mass | 243.08300 |
| PSA | 64.87000 |
| LogP | 3.57930 |
| Vapour Pressure | 2.28E-05mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | YUUGHESLMSQTDB-UHFFFAOYSA-N |
| SMILES | Cc1cccc[n+]1NC([S-])=Nc1ccccc1 |
|
~92%
Thiourea,N-(2-m... CAS#:28937-20-4 |
| Literature: Kakehi, Akikazu; Ito, Suketaka; Watanabe, Kozo; Ono, Tadashi; Miyazima, Tomio Journal of Chemical Research, Miniprint, 1980 , # 1 p. 401 - 425 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |