Butanamide,3-oxo-N-(3,4,5-trimethoxyphenyl)-
Modify Date: 2025-09-17 11:53:04
Butanamide,3-oxo-N-(3,4,5-trimethoxyphenyl)- structure
|
Common Name | Butanamide,3-oxo-N-(3,4,5-trimethoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2894-18-0 | Molecular Weight | 267.27800 | |
| Density | 1.189g/cm3 | Boiling Point | 440.7ºC at 760mmHg | |
| Molecular Formula | C13H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | 3,4,5-trimethoxy-acetoacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 440.7ºC at 760mmHg |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.27800 |
| Flash Point | 220.3ºC |
| Exact Mass | 267.11100 |
| PSA | 73.86000 |
| LogP | 1.70300 |
| Vapour Pressure | 5.79E-08mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | KOEZBVSSFMOARF-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)CC(C)=O)cc(OC)c1OC |
| HS Code | 2924299090 |
|---|
|
~58%
Butanamide,3-ox... CAS#:2894-18-0 |
| Literature: Bartolucci; Cellai; Di Filippo; Brizzi; Pellerano; Savini; Benedetto; Elia Farmaco, 1992 , vol. 47, # 6 p. 945 - 952 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetoacet-3,4,5-trimethoxyanilid |
| 3-keto-N-(3,4,5-trimethoxyphenyl)butyramide |
| 3,4,5-TRIMETHOXY-ACETOACETANILID |
| ACETOACET-3,4,5-TRIMETHOXYANILIDE |