Methanone,[2-(4-methylphenyl)diazenyl]nitro-, 2-(4-methylphenyl)hydrazone structure
|
Common Name | Methanone,[2-(4-methylphenyl)diazenyl]nitro-, 2-(4-methylphenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 28952-14-9 | Molecular Weight | 297.31200 | |
| Density | 1.24g/cm3 | Boiling Point | 454.4ºC at 760mmHg | |
| Molecular Formula | C15H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | N'-(4-methylanilino)-N-(4-methylphenyl)imino-1-nitro-N-oxido-N-oxomethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 454.4ºC at 760mmHg |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.31200 |
| Flash Point | 228.6ºC |
| Exact Mass | 297.12300 |
| PSA | 94.93000 |
| LogP | 4.64310 |
| Vapour Pressure | 1.91E-08mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | LKZGISCSQMBLRH-DUNJHAFCSA-N |
| SMILES | Cc1ccc(N=NC(=NNc2ccc(C)cc2)[N+](=O)[O-])cc1 |
|
~88%
Methanone,[2-(4... CAS#:28952-14-9 |
| Literature: Von Eschwege, Karel G. Journal of Photochemistry and Photobiology A: Chemistry, 2013 , vol. 252, p. 159 - 166 |
|
~%
Methanone,[2-(4... CAS#:28952-14-9 |
| Literature: Hubbard; Scott Journal of the American Chemical Society, 1943 , vol. 65, p. 2390,2391 |
| 1,1'-ditolyl-2,2'-diethylenyl ketone |
| pentaethylene glycol ditosylate |
| 1,5-pentanediol di-p-tosylate |
| 1,5-Di-p-tolyl-3-nitro-formazan |
| 3-nitro-1,5-dip-tolylformazan |
| 1,5-p-tolyl-3-nitroformazan |
| 1,5-Di-p-tolyl-penta-1,4-dien-3-on |
| 3-nitro-1,5-di-p-tolyl-3-nitroformazan |
| 1,5-pentandiol ditosylate |
| 1,5-di-p-tolyl-penta-1,4-dien-3-one |