H-Arg-Val-OH acetate salt
H-Arg-Val-OH acetate salt structure
|
Common Name | H-Arg-Val-OH acetate salt | ||
|---|---|---|---|---|
| CAS Number | 2896-20-0 | Molecular Weight | 333.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H27N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H27N5O5 |
|---|---|
| Molecular Weight | 333.38400 |
| Exact Mass | 333.20100 |
| PSA | 191.62000 |
| LogP | 1.17540 |
| InChIKey | DAQIJMOLTMGJLO-YUMQZZPRSA-N |
| SMILES | CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2925290090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-L-arginyl-L-valine |
| L-Valine,L-arginyl |
| L-Arginyl-L-valin |
| N-L-Arginyl-L-valin |
| L-Arg-L-Val |
| Arginyl-Valine |
| L-arginyl-L-valine |
| H-ARG-VAL-OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: Polar surface area (PSA) of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is 191.62000. |
| Q: What English synonyms does (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid have? |
| A: English synonyms of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid: N-L-arginyl-L-valine, L-Valine,L-arginyl, L-Arginyl-L-valin, N-L-Arginyl-L-valin, L-Arg-L-Val, Arginyl-Valine, L-arginyl-L-valine, H-ARG-VAL-OH. |
| Q: What is the LogP of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: LogP of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is 1.17540. |
| Q: What is the English name of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: The English name of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid. |
| Q: What is the SMILES notation of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: SMILES notation of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)O. |
| Q: What is the CAS number of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: CAS number of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is 2896-20-0. |
| Q: What is the InChIKey of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: InChIKey of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is DAQIJMOLTMGJLO-YUMQZZPRSA-N. |
| Q: What is the molecular weight of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: Molecular weight of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is 333.38400. |
| Q: What is the Chinese name of 2896-20-0? |
| A: Chinese name of 2896-20-0 is 2896-20-0. |
| Q: What is the molecular formula of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid? |
| A: Molecular formula of (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid is C13H27N5O5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |