2-Ethyl-1H-benzo[de]isoquinoline-1,3(2H)-dione
![2-Ethyl-1H-benzo[de]isoquinoline-1,3(2H)-dione Structure](https://image.chemsrc.com/caspic/389/2896-23-3.png)
2-Ethyl-1H-benzo[de]isoquinoline-1,3(2H)-dione structure
|
Common Name | 2-Ethyl-1H-benzo[de]isoquinoline-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 2896-23-3 | Molecular Weight | 225.24300 | |
| Density | 1.292±0.06 g/cm3(Predicted) | Boiling Point | 390.9±11.0 °C(Predicted) | |
| Molecular Formula | C14H11NO2 | Melting Point | 157 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-ethyl-1,8-naphthalimide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.292±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 390.9±11.0 °C(Predicted) |
| Melting Point | 157 °C |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24300 |
| Exact Mass | 225.07900 |
| PSA | 39.07000 |
| LogP | 1.97260 |
| InChIKey | YATFILGBMGSWTE-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)c2cccc3cccc(c23)C1=O |
| Storage condition | 2-8°C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of recombinant human CYP1B1 using 7-ER as substrate in presence of NADPH b...
Source: ChEMBL
Target: Cytochrome P450 1B1
External Id: CHEMBL5551521
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Ethyl-naphthalin-1,8-dicarbonsaeure-imid |
| N-Ethyl-naphthalsaeureimid |
| 2-ethyl-benz[de]isoquinoline-1,3-dione |
| 2-ethyl-benzo[de]isoquinoline-1,3-dione |
| 2-Aethyl-benz[de]isochinolin-1,3-dion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does N-ethyl-1,8-naphthalimide have? |
| A: English synonyms of N-ethyl-1,8-naphthalimide: N-Ethyl-naphthalin-1,8-dicarbonsaeure-imid, N-Ethyl-naphthalsaeureimid, 2-ethyl-benz[de]isoquinoline-1,3-dione, 2-ethyl-benzo[de]isoquinoline-1,3-dione, 2-Aethyl-benz[de]isochinolin-1,3-dion. |
| Q: What is the polar surface area (PSA) of N-ethyl-1,8-naphthalimide? |
| A: Polar surface area (PSA) of N-ethyl-1,8-naphthalimide is 39.07000. |
| Q: What is the melting point of N-ethyl-1,8-naphthalimide? |
| A: Melting point of N-ethyl-1,8-naphthalimide is 157 °C. |
| Q: What is the LogP of N-ethyl-1,8-naphthalimide? |
| A: LogP of N-ethyl-1,8-naphthalimide is 1.97260. |
| Q: What is the SMILES notation of N-ethyl-1,8-naphthalimide? |
| A: SMILES notation of N-ethyl-1,8-naphthalimide is CCN1C(=O)c2cccc3cccc(c23)C1=O. |
| Q: What is the English name of N-ethyl-1,8-naphthalimide? |
| A: The English name of N-ethyl-1,8-naphthalimide is N-ethyl-1,8-naphthalimide. |
| Q: What is the CAS number of N-ethyl-1,8-naphthalimide? |
| A: CAS number of N-ethyl-1,8-naphthalimide is 2896-23-3. |
| Q: What is the boiling point of N-ethyl-1,8-naphthalimide? |
| A: Boiling point of N-ethyl-1,8-naphthalimide is 390.9±11.0 °C(Predicted). |
| Q: What is the molecular weight of N-ethyl-1,8-naphthalimide? |
| A: Molecular weight of N-ethyl-1,8-naphthalimide is 225.24300. |
| Q: What is the molecular formula of N-ethyl-1,8-naphthalimide? |
| A: Molecular formula of N-ethyl-1,8-naphthalimide is C14H11NO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |