ethyl 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylate structure
|
Common Name | ethyl 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 289651-81-6 | Molecular Weight | 272.32200 | |
| Density | 1.32g/cm3 | Boiling Point | 436.8ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | ethyl 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760 mmHg |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.32200 |
| Flash Point | 218ºC |
| Exact Mass | 272.06200 |
| PSA | 72.36000 |
| LogP | 3.26370 |
| Vapour Pressure | 7.84E-08mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | KEXSQRQUXNOTTA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2nc(-n3cccc3)sc2c1 |
| HS Code | 2934200090 |
|---|
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 2-(1H-pyrrol-1-yl)-1,3-benzothiazole-6-carboxylate |
| HMS559I10 |