Alonimide structure
|
Common Name | Alonimide | ||
|---|---|---|---|---|
| CAS Number | 2897-83-8 | Molecular Weight | 243.25800 | |
| Density | 1.33g/cm3 | Boiling Point | 510.9ºC at 760mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.6ºC | |
| Name | spiro[2,3-dihydronaphthalene-4,3'-piperidine]-1,2',6'-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 510.9ºC at 760mmHg |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.25800 |
| Flash Point | 218.6ºC |
| Exact Mass | 243.09000 |
| PSA | 66.73000 |
| LogP | 1.61340 |
| Vapour Pressure | 1.48E-10mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | WZAIVXXKOAWTGQ-UHFFFAOYSA-N |
| SMILES | O=C1CCC2(CCC(=O)c3ccccc32)C(=O)N1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-dihydrospiro[naphthalene-1(4H),3'-piperidine]-2',4,6'-trione |
| Alonimida |
| Alonimide |
| ALONIMID |
| 1,2-dihydrospiro<naphthalene-1,3'-piperidine>-4-oxo-2'6'-dione |
| Alonimid (USAN/INN) |
| Alonimidum [INN-Latin] |
| Alonimida [INN-Spanish] |
| 2,3-dihydro-spiro[naphthalene-1,3'-piperidine]-4,2',6'-trione |
| 2,3-Dihydrospiro<naphthalin-1(4H),3'-piperidin>-2',4,6'-trion |
| Alonimide [INN-French] |
| 2,3-Dihydro-spiro[naphthalin-1,3'-piperidin]-4,2',6'-trion |
| Alonimidum |