7-Nitro-8-quinolinol 3-(2,4-dichlorophenyl)propenoate structure
|
Common Name | 7-Nitro-8-quinolinol 3-(2,4-dichlorophenyl)propenoate | ||
|---|---|---|---|---|
| CAS Number | 29002-05-9 | Molecular Weight | 389.18900 | |
| Density | 1.502g/cm3 | Boiling Point | 598.5ºC at 760mmHg | |
| Molecular Formula | C18H10Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.7ºC | |
| Name | (7-nitroquinolin-8-yl) (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.502g/cm3 |
|---|---|
| Boiling Point | 598.5ºC at 760mmHg |
| Molecular Formula | C18H10Cl2N2O4 |
| Molecular Weight | 389.18900 |
| Flash Point | 315.7ºC |
| Exact Mass | 388.00200 |
| PSA | 85.01000 |
| LogP | 5.59180 |
| Vapour Pressure | 2.77E-14mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | ZKKHJKJGIQZKJE-VMPITWQZSA-N |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Oc1c([N+](=O)[O-])ccc2cccnc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CINNAMIC ACID,2,4-DICHLORO-,7-NITRO-8-QUINOLYL ESTER |
| 2,4-Dichlorocinnamic acid 7-nitro-8-quinolyl ester |