3-(4-Methoxyphenyl)propenoic acid 7-nitro-8-quinolyl ester structure
|
Common Name | 3-(4-Methoxyphenyl)propenoic acid 7-nitro-8-quinolyl ester | ||
|---|---|---|---|---|
| CAS Number | 29002-06-0 | Molecular Weight | 350.32500 | |
| Density | 1.352g/cm3 | Boiling Point | 586.1ºC at 760mmHg | |
| Molecular Formula | C19H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.3ºC | |
| Name | (7-nitroquinolin-8-yl) (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 586.1ºC at 760mmHg |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.32500 |
| Flash Point | 308.3ºC |
| Exact Mass | 350.09000 |
| PSA | 94.24000 |
| LogP | 4.29360 |
| Vapour Pressure | 1.01E-13mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | XKRSDGMWULQKLL-IZZDOVSWSA-N |
| SMILES | COc1ccc(C=CC(=O)Oc2c([N+](=O)[O-])ccc3cccnc23)cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-Methoxycinnamic acid 7-nitro-8-quinolyl ester |
| CINNAMIC ACID,p-METHOXY-,7-NITRO-8-QUINOLYL ESTER |