L-N-acetyl-Tyrosine
Modify Date: 2025-08-25 11:30:10
L-N-acetyl-Tyrosine structure
|
Common Name | L-N-acetyl-Tyrosine | ||
|---|---|---|---|---|
| CAS Number | 2901-77-1 | Molecular Weight | 223.225 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 531.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.1±28.7 °C | |
| Name | N-alpha-acetyl-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.3±45.0 °C at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.225 |
| Flash Point | 275.1±28.7 °C |
| Exact Mass | 223.084457 |
| PSA | 86.63000 |
| LogP | 0.04 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | CAHKINHBCWCHCF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: ULK1_INH_LUMI_1536_1X%INH PRUN
|
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
|
Name: Displacement of 1,8-ANS from His6-tagged FABP4 (unknown origin) expressed in Escheric...
Source: ChEMBL
Target: Fatty acid-binding protein, adipocyte
External Id: CHEMBL3830761
|
|
Name: Enzymatic assay of human HDAC6 with commercial peptide substrate
Source: ChEMBL
Target: Histone deacetylase 6
External Id: CHEMBL4808149
|
|
Name: uHTS identification of small molecule modulators of Rev-erb Alpha.
Source: Burnham Center for Chemical Genomics
Target: N/A
External Id: SBCCG-A1016-RevErbaLBD-Primary-Assay
|
|
Name: Enzymatic assay of human HDAC6 with custom peptide substrate
Source: ChEMBL
Target: Histone deacetylase 6
External Id: CHEMBL4808150
|
|
Name: Binding affinity to His6-tagged FABP4 (unknown origin) expressed in Escherichia coli ...
Source: ChEMBL
Target: Fatty acid-binding protein, adipocyte
External Id: CHEMBL3830763
|
Total 7, Current Page 1 of 1
1
| 2-Acetamido-3-(4-hydroxyphenyl)propanoic acid |
| (2S)-2-(acetylamino)-3-(4-hydroxyphenyl)propanoic acid |
| 2-(acetylamino)-3-(4-hydroxyphenyl)propanoic acid |
| (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid |
| Ac-Tyr-OH |
| acetyl-tyrosine |
| N-Acetyltyrosine |
| N-Acetyltyrosine (VAN) |
| N-acetyl-tyrosine |
| (2S)-2-Acetylamino-3-(4-hydroxyphenyl)propanoic acid |
| N-acetyl-D,L-tyrosine |
| L-N-acetyl-Tyrosine |
| N-acetyl-DL-tyrosine |
| N-Acetyl-L-tyrosine |