1(3H)-Isobenzofuranone, 3-hydroxy-3-(trichloromethyl)- structure
|
Common Name | 1(3H)-Isobenzofuranone, 3-hydroxy-3-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 2902-71-8 | Molecular Weight | 267.49300 | |
| Density | 1.755g/cm3 | Boiling Point | 456.8ºC at 760mmHg | |
| Molecular Formula | C9H5Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | 3-hydroxy-3-(trichloromethyl)-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.755g/cm3 |
|---|---|
| Boiling Point | 456.8ºC at 760mmHg |
| Molecular Formula | C9H5Cl3O3 |
| Molecular Weight | 267.49300 |
| Flash Point | 230ºC |
| Exact Mass | 265.93000 |
| PSA | 46.53000 |
| LogP | 2.37230 |
| Vapour Pressure | 3.89E-09mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | QOYSPUANDGEOID-UHFFFAOYSA-N |
| SMILES | O=C1OC(O)(C(Cl)(Cl)Cl)c2ccccc21 |
|
~%
1(3H)-Isobenzof... CAS#:2902-71-8 |
| Literature: Bowden, Keith; Misic-Vukovic, Milica M.; Ranson, Richard J. Collection of Czechoslovak Chemical Communications, 1999 , vol. 64, # 10 p. 1601 - 1606 |
| 3-Hydroxy-3-trichlormethyl-phthalid |