4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide
Modify Date: 2025-09-20 15:58:41
4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide structure
|
Common Name | 4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 290331-05-4 | Molecular Weight | 303.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClF2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide |
|---|
| Molecular Formula | C12H8ClF2NO2S |
|---|---|
| Molecular Weight | 303.71200 |
| Exact Mass | 302.99300 |
| PSA | 54.55000 |
| LogP | 4.57280 |
| InChIKey | XNVSMXIZNGAENB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1cc(F)ccc1F)c1ccc(Cl)cc1 |
| HS Code | 2935009090 |
|---|
|
~85%
4-chloro-N-(2,5... CAS#:290331-05-4 |
| Literature: BAYER HEALTHCARE AG Patent: WO2004/80952 A1, 2004 ; Location in patent: Page 28 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: In vitro inhibition of gamma-secretase as amyloid peptide production in SH-SY5Y cells
Source: ChEMBL
Target: Gamma-secretase subunit APH-1B
External Id: CHEMBL833472
|
|
Name: ASTRAZENECA: Octan-1-ol/water (pH7.4) distribution coefficent measured by a shake fl...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3301363
|
Total 2, Current Page 1 of 1
1