3-(tert-Butyl)benzene-1-sulfonyl chloride structure
|
Common Name | 3-(tert-Butyl)benzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2905-26-2 | Molecular Weight | 232.72700 | |
| Density | 1.207g/cm3 | Boiling Point | 301.9ºC at 760 mmHg | |
| Molecular Formula | C10H13ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.4ºC | |
| Name | 3-tert-Butylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 301.9ºC at 760 mmHg |
| Molecular Formula | C10H13ClO2S |
| Molecular Weight | 232.72700 |
| Flash Point | 136.4ºC |
| Exact Mass | 232.03200 |
| PSA | 42.52000 |
| LogP | 3.99240 |
| Vapour Pressure | 0.00183mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | WZQSQOIYTVCFMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cccc(S(=O)(=O)Cl)c1 |
| Storage condition | 2-8°C |
| HS Code | 2904909090 |
|---|
|
~%
3-(tert-Butyl)b... CAS#:2905-26-2 |
| Literature: Prinsen,A.J.; Cerfontain,H. Recueil des Travaux Chimiques des Pays-Bas, 1965 , vol. 84, p. 24 - 30 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-tert-Butylbenzenesulphonyl chloride |
| 3-(1,1-dimethylethyl)benzene-sulphonyl chloride |
| 3-(tert-Butyl)benzene-1-sulfonyl chloride |
| 3-tert-butyl-benzenesulfonyl chloride |
| m-tert.-Butyl-benzolsulfonylchlorid |
| 3-(1,1-dimethylethyl)benzenesulfonyl chloride |