2,4(1H,3H)-Pyrimidinedione,1-methyl-6-(methylamino)-5-nitroso- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,1-methyl-6-(methylamino)-5-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 29052-39-9 | Molecular Weight | 184.15300 | |
| Density | 1.59g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H8N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-6-(methylamino)-5-nitrosopyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.15300 |
| Exact Mass | 184.06000 |
| PSA | 96.32000 |
| Index of Refraction | 1.664 |
| InChIKey | VEMYBCCEXKJJNR-UHFFFAOYSA-N |
| SMILES | CNc1c(N=O)c(=O)[nH]c(=O)n1C |
|
~%
2,4(1H,3H)-Pyri... CAS#:29052-39-9 |
| Literature: Youssef, Shaker; Pfleiderer, Wolfgang Journal of Heterocyclic Chemistry, 1998 , vol. 35, # 4 p. 949 - 954 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1-methyl-6-(methylamino)-5-nitrosouracil |
| 1-methyl-6-methylamino-5-nitroso-1H-pyrimidine-2,4-dione |
| 6-methylamino-1-methyl-5-nitrosouracil |
| 6-methylamine-1-methyl-5-nitrosouracil |
| 1-methyl-6-(methylamino)-5-nitrosopyrimidine-2,4(1h,3h)-dione |