(4-amino-2-methyl-pyrimidin-5-yl)methanesulfonic acid
(4-amino-2-methyl-pyrimidin-5-yl)methanesulfonic acid structure
|
Common Name | (4-amino-2-methyl-pyrimidin-5-yl)methanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 2908-73-8 | Molecular Weight | 203.21900 | |
| Density | 1.571g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.571g/cm3 |
|---|---|
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.21900 |
| Exact Mass | 203.03600 |
| PSA | 114.55000 |
| LogP | 1.41700 |
| Index of Refraction | 1.622 |
| InChIKey | BONBSNIMLNTEIY-UHFFFAOYSA-N |
| SMILES | Cc1ncc(CS(=O)(=O)O)c(N)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(4-amino-2-meth... CAS#:2908-73-8 |
| Literature: Grewe Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1936 , vol. 242, p. 89,94 |
|
~%
(4-amino-2-meth... CAS#:2908-73-8 |
| Literature: Zoltewicz, John A.; Uray, Georg Journal of Organic Chemistry, 1981 , vol. 46, # 11 p. 2398 - 2400 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Amino-2-methylpyrimidinyl-5-methansulfonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: InChIKey of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid is BONBSNIMLNTEIY-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: Polar surface area (PSA) of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid is 114.55000. |
| Q: What is the molecular weight of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: Molecular weight of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid is 203.21900. |
| Q: What is the Chinese name of 2908-73-8? |
| A: Chinese name of 2908-73-8 is 2908-73-8. |
| Q: What is the LogP of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: LogP of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid is 1.41700. |
| Q: What is the English name of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: The English name of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid is (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid. |
| Q: What are the upstream materials of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: Related upstream materials(CAS) of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid: 25526-81-2;59-43-8. |
| Q: What is the molecular formula of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: Molecular formula of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid is C6H9N3O3S. |
| Q: What is the SMILES notation of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid? |
| A: SMILES notation of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid is Cc1ncc(CS(=O)(=O)O)c(N)n1. |
| Q: What English synonyms does (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid have? |
| A: English synonyms of (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid: 4-Amino-2-methylpyrimidinyl-5-methansulfonsaeure. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |