3,5,11,13-Pentadecanetetrone,1,15-diphenyl
Modify Date: 2025-09-19 09:23:43
3,5,11,13-Pentadecanetetrone,1,15-diphenyl structure
|
Common Name | 3,5,11,13-Pentadecanetetrone,1,15-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 2909-96-8 | Molecular Weight | 420.54100 | |
| Density | 1.089g/cm3 | Boiling Point | 595.3ºC at 760 mmHg | |
| Molecular Formula | C27H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.3ºC | |
| Name | 1,15-diphenylpentadecane-3,5,11,13-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 595.3ºC at 760 mmHg |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.54100 |
| Flash Point | 265.3ºC |
| Exact Mass | 420.23000 |
| PSA | 68.28000 |
| LogP | 5.25910 |
| Vapour Pressure | 3.89E-14mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | INXMFTOKOMKMOL-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCC(=O)CC(=O)CCc1ccccc1)CC(=O)CCc1ccccc1 |
|
~%
3,5,11,13-Penta... CAS#:2909-96-8 |
| Literature: Hampton,K.G.; Hauser,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 2934 - 2937 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,15-Diphenyl-3,5,11,13-pentadecantetron |