Phenol,2,2'-sulfinylbis[4-chloro- (6CI,7CI,8CI,9CI) structure
|
Common Name | Phenol,2,2'-sulfinylbis[4-chloro- (6CI,7CI,8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 29097-31-2 | Molecular Weight | 303.16100 | |
| Density | 1.71g/cm3 | Boiling Point | 516.3ºC at 760mmHg | |
| Molecular Formula | C12H8Cl2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266ºC | |
| Name | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfinylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Boiling Point | 516.3ºC at 760mmHg |
| Molecular Formula | C12H8Cl2O3S |
| Molecular Weight | 303.16100 |
| Flash Point | 266ºC |
| Exact Mass | 301.95700 |
| PSA | 76.74000 |
| LogP | 4.43700 |
| Vapour Pressure | 2.8E-11mmHg at 25°C |
| Index of Refraction | 1.762 |
| InChIKey | RTKDHPNYIPCHSF-UHFFFAOYSA-N |
| SMILES | O=S(c1cc(Cl)ccc1O)c1cc(Cl)ccc1O |
|
~%
Phenol,2,2'-sul... CAS#:29097-31-2 |
| Literature: Gazdar; Smiles Journal of the Chemical Society, 1910 , vol. 97, p. 2252 |
|
~%
Phenol,2,2'-sul... CAS#:29097-31-2 |
| Literature: Gazdar; Smiles Journal of the Chemical Society, 1910 , vol. 97, p. 2252 |
| 4,4'-Dichlor-2,2'-sulfinyl-di-phenol |
| 5.5'-Dichlor-2.2'-dioxy-diphenylsulfoxyd |
| 4,4'-dichloro-2,2'-sulfinyl-di-phenol |