3,3'',5,5''-Tetrabromo-5'-(3,5-dibromophenyl)-1,1':3',1''-terphenyl structure
|
Common Name | 3,3'',5,5''-Tetrabromo-5'-(3,5-dibromophenyl)-1,1':3',1''-terphenyl | ||
|---|---|---|---|---|
| CAS Number | 29102-67-8 | Molecular Weight | 779.77600 | |
| Density | 2.039 g/cm3 | Boiling Point | 623.1ºC at 760 mmHg | |
| Molecular Formula | C24H12Br6 | Melting Point | 315 °C | |
| MSDS | N/A | Flash Point | 316.4ºC | |
| Name | 1,3,5-tris(3,5-dibromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.039 g/cm3 |
|---|---|
| Boiling Point | 623.1ºC at 760 mmHg |
| Melting Point | 315 °C |
| Molecular Formula | C24H12Br6 |
| Molecular Weight | 779.77600 |
| Flash Point | 316.4ºC |
| Exact Mass | 773.60400 |
| LogP | 11.26260 |
| InChIKey | VBMGLVNBADCRDN-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)cc(-c2cc(-c3cc(Br)cc(Br)c3)cc(-c3cc(Br)cc(Br)c3)c2)c1 |
|
~49%
3,3'',5,5''-Tet... CAS#:29102-67-8 |
| Literature: Cao, Xiao-Yu; Liu, Xue-Hui; Zhou, Xing-Hua; Zhang, Yong; Jiang, Yang; Cao, Yong; Cui, Yu-Xin; Pei, Jian Journal of Organic Chemistry, 2004 , vol. 69, # 18 p. 6050 - 6058 |
|
~%
3,3'',5,5''-Tet... CAS#:29102-67-8 |
| Literature: Miller, Timothy M.; Neenan, Thomas X.; Zayas, Roberto; Bair, Harvey E. Journal of the American Chemical Society, 1992 , vol. 114, # 3 p. 1018 - 1025 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1':3',1''-Terphenyl,3,3'',5,5''-tetrabromo-5-(3,5-dibromophenyl) |
| 1,3,5-tri(3,5-dibromophenyl)benzene |
| 3',5',3',5',3'',5''-Hexabromo-triphenylbenzol |
| 3,3'',5,5''-Tetrabromo-5'-(3,5-dibromophenyl)-1,1':3',1''-terphenyl |
| 1,3,5-tris(3',5'-dibromophenyl)benzene |
| 1,3,5-Tris(3,5-dibromophenyl)benzene |