N,N'-Bis(4-aminophenyl)-N,N'-dimethylethylenediamine structure
|
Common Name | N,N'-Bis(4-aminophenyl)-N,N'-dimethylethylenediamine | ||
|---|---|---|---|---|
| CAS Number | 29103-75-1 | Molecular Weight | 270.373 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 476.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.7±12.5 °C | |
| Name | 4-N-[2-(4-amino-N-methylanilino)ethyl]-4-N-methylbenzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.4±30.0 °C at 760 mmHg |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.373 |
| Flash Point | 275.7±12.5 °C |
| Exact Mass | 270.184448 |
| PSA | 58.52000 |
| LogP | 1.08 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | QEDHNSAOECJYDI-UHFFFAOYSA-N |
| SMILES | CN(CCN(C)c1ccc(N)cc1)c1ccc(N)cc1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,4-Benzenediamine, N,N-1,2-ethanediylbis[N-methyl- |
| N,N'-Ethane-1,2-diylbis(N-methylbenzene-1,4-diamine) |
| N,N'-1,2-Ethanediylbis(N-methyl-1,4-benzenediamine) |