Benzoic acid, anhydride with 3-chloro-2,6-dimethoxy-N-(2-propenyloxy)benzenecarboximidic acid structure
|
Common Name | Benzoic acid, anhydride with 3-chloro-2,6-dimethoxy-N-(2-propenyloxy)benzenecarboximidic acid | ||
|---|---|---|---|---|
| CAS Number | 29104-32-3 | Molecular Weight | 375.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzoic acid, anhydride with 3-chloro-2,6-dimethoxy-N-(2-propenyloxy)benzenecarboximidic acid |
|---|
| Molecular Formula | C19H18ClNO5 |
|---|---|
| Molecular Weight | 375.8 |
| InChIKey | UHURCULRNYJSKN-UHFFFAOYSA-N |
| SMILES | C=CCON=C(OC(=O)c1ccccc1)c1c(OC)ccc(Cl)c1OC |