Frequentin structure
|
Common Name | Frequentin | ||
|---|---|---|---|---|
| CAS Number | 29119-03-7 | Molecular Weight | 252.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FrequentinFrequentin is an antibiotic originally isolated from P. frequentans that is active against bacteria (MICs = 300 and 200 μg/ml for S. aureus and B. subtilis, respectively) and fungi |
| Name | frequentin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O4 |
|---|---|
| Molecular Weight | 252.30600 |
| Exact Mass | 252.13600 |
| PSA | 74.60000 |
| LogP | 1.02480 |
| InChIKey | MHZVWXOKIRZLCJ-RVZXZRSKSA-N |
| SMILES | CCCC=CC=CC1CC(O)C(O)C(=O)C1C=O |
| 1H-Isoindole,5-bromo-2,3-dihydro-1-methyl-2-(triphenylmethyl)-,(1R) |
| (+)-(R)-5-bromo-1-methyl-2-(triphenylmethyl)isoindoline |
| (1R)-6t-hepta-1,3t-dien-t-yl-3c,4c-dihydroxy-2-oxo-cyclohexane-r-carbaldehyde |
| (1R)-6t-Hepta-1,3t-dien-t-yl-3c,4c-dihydroxy-2-oxo-cyclohexan-r-carbaldehyd |
| (1R)-5-bromo-1-methyl-2-trityl-2,3-dihydro-1H-isoindole |
| Frequentine |