Quercetin 3,4'-diglucoside structure
|
Common Name | Quercetin 3,4'-diglucoside | ||
|---|---|---|---|---|
| CAS Number | 29125-80-2 | Molecular Weight | 626.51700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H30O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Quercetin 3,4'-diglucosideQuercetin-3,4-di-O-glucoside is a flavonoid that can be isolated from Allium cepa[1]. |
| Name | 4-[3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-4-oxo-4H-chromen-2-yl] -2-hydroxyphenyl β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Quercetin-3,4-di-O-glucoside is a flavonoid that can be isolated from Allium cepa[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Torgils Fossen, et al. Flavonoids from red onion (Allium cepa). , 47(2), 281–285. |
| Molecular Formula | C27H30O17 |
|---|---|
| Molecular Weight | 626.51700 |
| Exact Mass | 626.14800 |
| PSA | 289.66000 |
| InChIKey | RPVIQWDFJPYNJM-DEFKTLOSSA-N |
| SMILES | O=c1c(OC2OC(CO)C(O)C(O)C2O)c(-c2ccc(OC3OC(CO)C(O)C(O)C3O)c(O)c2)oc2cc(O)cc(O)c12 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1-(4-nitrophenoxymethyl)-4-methoxybenzene |
| quercetin-3,4'-diglucoside |
| 4'-methoxybenzyloxy-4-nitrobenzene |
| p-nitrophenyl p-methoxybenzyl ether |
| quercetin 3,4'-O-diglucoside |