Dibutyl azelate structure
|
Common Name | Dibutyl azelate | ||
|---|---|---|---|---|
| CAS Number | 2917-73-9 | Molecular Weight | 300.43400 | |
| Density | 0.95g/cm3 | Boiling Point | 336ºC | |
| Molecular Formula | C17H32O4 | Melting Point | 107-108ºC | |
| MSDS | USA | Flash Point | 152ºC | |
| Name | dibutyl nonanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 336ºC |
| Melting Point | 107-108ºC |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.43400 |
| Flash Point | 152ºC |
| Exact Mass | 300.23000 |
| PSA | 52.60000 |
| LogP | 4.40370 |
| Vapour Pressure | 9.41E-05mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | RISLXYINQFKFRL-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CCCCCCCC(=O)OCCCC |
| HS Code | 2917139000 |
|---|
|
~%
Dibutyl azelate CAS#:2917-73-9 |
| Literature: Zerda, Jaime de la; Barak, Gabriela; Sasson, Yoel Tetrahedron, 1989 , vol. 45, # 5 p. 1533 - 1536 |
|
~%
Dibutyl azelate CAS#:2917-73-9 |
| Literature: Williams Industrial and Engineering Chemistry, 1947 , vol. 39, p. 779,780 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917139000 |
|---|---|
| Summary | 2917139000 azelaic acid, sebacic acid, their salts and esters VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ergoplast AZDB |
| Azelainsaeuredibutylester |
| Dibutylazelat |
| Nonandisaeure-dibutylester |
| Dibutyl azelaate |
| EINECS 220-850-8 |
| Azelaic acid,dibutyl ester |
| Nonanedioic acid,dibutyl ester |
| DIBUTYL AZELATE |
| di-n-butyl azelate |
| 1,9-Di-n-butyl nonanedioate |