trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane
trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane structure
|
Common Name | trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 29173-25-9 | Molecular Weight | 225.47800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H23NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H23NSi2 |
|---|---|
| Molecular Weight | 225.47800 |
| Exact Mass | 225.13700 |
| PSA | 3.24000 |
| LogP | 3.81060 |
| InChIKey | MJLQTXJEKQTNRI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1C=CN([Si](C)(C)C)C=C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~33%
trimethyl-(1-tr... CAS#:29173-25-9 |
| Literature: Tsuge, Otohiko; Kanemasa, Shuji; Naritomi, Toshio; Tanaka, Junji Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 4 p. 1497 - 1504 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 8 | |
CAS#:110823-85-3
CAS#:110823-86-4
CAS#:554-12-1
CAS#:34865-03-7
CAS#:107-12-0
CAS#:1802-20-6
CAS#:620-95-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: Related upstream materials(CAS) of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane: 110-86-1;75-77-4. |
| Q: What is the InChIKey of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: InChIKey of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is MJLQTXJEKQTNRI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: SMILES notation of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is C[Si](C)(C)C1C=CN([Si](C)(C)C)C=C1. |
| Q: What is the LogP of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: LogP of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is 3.81060. |
| Q: What is the CAS number of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: CAS number of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is 29173-25-9. |
| Q: What is the molecular weight of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: Molecular weight of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is 225.47800. |
| Q: What is the molecular formula of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: Molecular formula of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is C11H23NSi2. |
| Q: What is the polar surface area (PSA) of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: Polar surface area (PSA) of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is 3.24000. |
| Q: What are the downstream products of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: Related downstream products(CAS) of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane: 110823-85-3;110823-86-4;18301-46-7;554-12-1;34865-03-7;107-12-0;1802-20-6;620-95-1. |
| Q: What is the English name of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane? |
| A: The English name of trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane is trimethyl-(1-trimethylsilyl-4H-pyridin-4-yl)silane. |