Benzoic acid,4-(2-phenyldiazenyl)-, methyl ester structure
|
Common Name | Benzoic acid,4-(2-phenyldiazenyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 2918-88-9 | Molecular Weight | 240.25700 | |
| Density | 1.12g/cm3 | Boiling Point | 382.1ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | methyl 4-phenyldiazenylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760 mmHg |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.25700 |
| Flash Point | 174.5ºC |
| Exact Mass | 240.09000 |
| PSA | 51.02000 |
| LogP | 3.88860 |
| Vapour Pressure | 4.84E-06mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | SUFXZYCPKGRJIZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N=Nc2ccccc2)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
Benzoic acid,4-... CAS#:2918-88-9 |
| Literature: Budesinsky, Milos; Exner, Otto Magnetic Resonance in Chemistry, 1989 , vol. 27, # 6 p. 585 - 591 |
|
~%
Benzoic acid,4-... CAS#:2918-88-9 |
| Literature: Muxfeldt,H. et al. Chemische Berichte, 1965 , vol. 98, p. 3040 - 3044 |
|
~%
Benzoic acid,4-... CAS#:2918-88-9 |
| Literature: Lund, Torben; Lund, Henning Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1986 , vol. 40, # 6 p. 470 - 485 |
|
~%
Benzoic acid,4-... CAS#:2918-88-9 |
| Literature: Jacobson; Steinbrenk Justus Liebigs Annalen der Chemie, 1898 , vol. 303, p. 385 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-phenylazo-benzoic acid methyl ester |
| T0400-0273 |
| 4-methoxycarbonylazobenzene |
| Azobenzol-p-carbonsaeuremethylester |
| Azobenzol-4-carbonsaeure-methylester |
| p-methoxycarbonylazobenzene |
| 4-Phenylazo-benzoesaeure-methylester |