Menasylic acid
Menasylic acid structure
|
Common Name | Menasylic acid | ||
|---|---|---|---|---|
| CAS Number | 29181-96-2 | Molecular Weight | 222.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methylnaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10O3S |
|---|---|
| Molecular Weight | 222.26000 |
| Exact Mass | 222.03500 |
| PSA | 62.75000 |
| LogP | 3.47570 |
| InChIKey | UGDHIURSEUVFCE-UHFFFAOYSA-N |
| SMILES | Cc1ccc2cc(S(=O)(=O)O)ccc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904100000 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Menasylic acid CAS#:29181-96-2 |
| Literature: Wendt Journal fuer Praktische Chemie (Leipzig), 1892 , vol. <2> 46, p. 317 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-methyl-naphthalene-2-sulfonic acid |
| 6-methyl-2-naphthalene sulfonic acid |
| 2-Naphthalenesulfonicacid,6-methyl |
| menasylic acid |
| 6-Methyl-naphthalin-2-sulfonsaeure |
| 2-Methylnaphthalin-6-sulfonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 29181-96-2? |
| A: Chinese name of 29181-96-2 is 29181-96-2. |
| Q: What is the molecular formula of 6-methylnaphthalene-2-sulfonic acid? |
| A: Molecular formula of 6-methylnaphthalene-2-sulfonic acid is C11H10O3S. |
| Q: What is the molecular weight of 6-methylnaphthalene-2-sulfonic acid? |
| A: Molecular weight of 6-methylnaphthalene-2-sulfonic acid is 222.26000. |
| Q: What is the LogP of 6-methylnaphthalene-2-sulfonic acid? |
| A: LogP of 6-methylnaphthalene-2-sulfonic acid is 3.47570. |
| Q: What is the polar surface area (PSA) of 6-methylnaphthalene-2-sulfonic acid? |
| A: Polar surface area (PSA) of 6-methylnaphthalene-2-sulfonic acid is 62.75000. |
| Q: What English synonyms does 6-methylnaphthalene-2-sulfonic acid have? |
| A: English synonyms of 6-methylnaphthalene-2-sulfonic acid: 6-methyl-naphthalene-2-sulfonic acid, 6-methyl-2-naphthalene sulfonic acid, 2-Naphthalenesulfonicacid,6-methyl, menasylic acid, 6-Methyl-naphthalin-2-sulfonsaeure, 2-Methylnaphthalin-6-sulfonsaeure. |
| Q: What is the SMILES notation of 6-methylnaphthalene-2-sulfonic acid? |
| A: SMILES notation of 6-methylnaphthalene-2-sulfonic acid is Cc1ccc2cc(S(=O)(=O)O)ccc2c1. |
| Q: What is the CAS number of 6-methylnaphthalene-2-sulfonic acid? |
| A: CAS number of 6-methylnaphthalene-2-sulfonic acid is 29181-96-2. |
| Q: What are the upstream materials of 6-methylnaphthalene-2-sulfonic acid? |
| A: Related upstream materials(CAS) of 6-methylnaphthalene-2-sulfonic acid: 91-57-6. |
| Q: What is the English name of 6-methylnaphthalene-2-sulfonic acid? |
| A: The English name of 6-methylnaphthalene-2-sulfonic acid is 6-methylnaphthalene-2-sulfonic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |