[3-(N-Ethylacetylamino)-2,4,6-triiodophenyl]acetic acid structure
|
Common Name | [3-(N-Ethylacetylamino)-2,4,6-triiodophenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 29193-33-7 | Molecular Weight | 598.94200 | |
| Density | 2.384g/cm3 | Boiling Point | 606.3ºC at 760mmHg | |
| Molecular Formula | C12H12I3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.5ºC | |
| Name | 2-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]acetic acid |
|---|
| Density | 2.384g/cm3 |
|---|---|
| Boiling Point | 606.3ºC at 760mmHg |
| Molecular Formula | C12H12I3NO3 |
| Molecular Weight | 598.94200 |
| Flash Point | 320.5ºC |
| Exact Mass | 598.79500 |
| PSA | 57.61000 |
| LogP | 3.50030 |
| Vapour Pressure | 1.49E-15mmHg at 25°C |
| Index of Refraction | 1.724 |
| InChIKey | NFKPJIQUXGRQFR-UHFFFAOYSA-N |
| SMILES | CCN(C(C)=O)c1c(I)cc(I)c(CC(=O)O)c1I |
| HS Code | 2924299090 |
|---|
|
~%
[3-(N-Ethylacet... CAS#:29193-33-7 |
| Literature: Felder; Pitre; Fumagalli; Lorenzotti Journal of medicinal chemistry, 1970 , vol. 13, # 3 p. 559 - 561 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |