[2,4,6-Triiodo-3-(N-propylacetylamino)phenyl]acetic acid
![[2,4,6-Triiodo-3-(N-propylacetylamino)phenyl]acetic acid Structure](https://image.chemsrc.com/caspic/225/29193-34-8.png)
[2,4,6-Triiodo-3-(N-propylacetylamino)phenyl]acetic acid structure
|
Common Name | [2,4,6-Triiodo-3-(N-propylacetylamino)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 29193-34-8 | Molecular Weight | 612.96900 | |
| Density | 2.289g/cm3 | Boiling Point | 611.2ºC at 760mmHg | |
| Molecular Formula | C13H14I3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.289g/cm3 |
|---|---|
| Boiling Point | 611.2ºC at 760mmHg |
| Molecular Formula | C13H14I3NO3 |
| Molecular Weight | 612.96900 |
| Flash Point | 323.5ºC |
| Exact Mass | 612.81100 |
| PSA | 57.61000 |
| LogP | 3.89040 |
| Vapour Pressure | 8.55E-16mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | RZTIXZDVPRNYRH-UHFFFAOYSA-N |
| SMILES | CCCN(C(C)=O)c1c(I)cc(I)c(CC(=O)O)c1I |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2,4,6-Triiodo-... CAS#:29193-34-8 |
| Literature: Felder; Pitre; Fumagalli; Lorenzotti Journal of medicinal chemistry, 1970 , vol. 13, # 3 p. 559 - 561 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 29193-34-8? |
| A: Chinese name of 29193-34-8 is 29193-34-8. |
| Q: What are the upstream materials of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: Related upstream materials(CAS) of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid: 3119-16-2;107-08-4. |
| Q: What is the molecular weight of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: Molecular weight of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is 612.96900. |
| Q: What is the LogP of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: LogP of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is 3.89040. |
| Q: What is the molecular formula of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: Molecular formula of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is C13H14I3NO3. |
| Q: What is the InChIKey of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: InChIKey of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is RZTIXZDVPRNYRH-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: Polar surface area (PSA) of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is 57.61000. |
| Q: What is the CAS number of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: CAS number of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is 29193-34-8. |
| Q: What is the English name of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: The English name of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid. |
| Q: What is the SMILES notation of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid? |
| A: SMILES notation of 2-[3-[acetyl(propyl)amino]-2,4,6-triiodophenyl]acetic acid is CCCN(C(C)=O)c1c(I)cc(I)c(CC(=O)O)c1I. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |