[1,1'-Biphenyl]-4-carboxaldehyde,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | [1,1'-Biphenyl]-4-carboxaldehyde,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 2920-39-0 | Molecular Weight | 362.33900 | |
| Density | 1.327g/cm3 | Boiling Point | 548.826ºC at 760 mmHg | |
| Molecular Formula | C19H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.72ºC | |
| Name | 2,4-dinitro-N-[(E)-(4-phenylphenyl)methylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 548.826ºC at 760 mmHg |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.33900 |
| Flash Point | 285.72ºC |
| Exact Mass | 362.10200 |
| PSA | 116.03000 |
| LogP | 5.73540 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | RCHIBUZNWDOSRE-DEDYPNTBSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccc(-c3ccccc3)cc2)c([N+](=O)[O-])c1 |
|
~%
[1,1'-Biphenyl]... CAS#:2920-39-0 |
| Literature: Hey Journal of the Chemical Society, 1931 , p. 2476,2477 |
|
~%
[1,1'-Biphenyl]... CAS#:2920-39-0 |
| Literature: Hey Journal of the Chemical Society, 1931 , p. 2476,2477 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| <4-Phenyl-benzaldehyd>-2.4-dinitrophenylhydrazon |
| Biphenyl-4-carbaldehyd-(2,4-dinitro-phenylhydrazon) |
| biphenyl-4-carbaldehyde-(2,4-dinitro-phenylhydrazone) |
| 1-(biphenyl-4-ylmethylidene)-2-(2,4-dinitrophenyl)hydrazine |